C17H12IN3O6 — CID 55389931
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55389931) has the molecular formula C17H12IN3O6 and a molecular weight of 481.20 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55389931 |
| Molecular Formula | C17H12IN3O6 |
| Molecular Weight | 481.20 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccc(I)o1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C17H12IN3O6/c1-10(25-15(22)9-7-13-6-8-14(18)26-13)16-19-20-17(27-16)11-2-4-12(5-3-11)21(23)24/h2-10H,1H3/b9-7+ |
| InChIKey | BVNZUVZBYJKJHA-VQHVLOKHSA-N |
| XLogP | 4.16 |
| TPSA | 121.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|