C25H32N2O6 — CID 55392787
1-O-tert-butyl 4-O-[(3-ethoxycarbonyl-4-methylquinolin-2-yl)methyl] piperidine-1,4-dicarboxylate (PubChem CID 55392787) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-[(3-ethoxycarbonyl-4-methylquinolin-2-yl)methyl] piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-[(3-ethoxycarbonyl-4-methylquinolin-2-yl)methyl] piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 55392787 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 1-O-tert-butyl 4-O-[(3-ethoxycarbonyl-4-methylquinolin-2-yl)methyl] piperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(COC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)nc2ccccc2c1C |
| InChI | InChI=1S/C25H32N2O6/c1-6-31-23(29)21-16(2)18-9-7-8-10-19(18)26-20(21)15-32-22(28)17-11-13-27(14-12-17)24(30)33-25(3,4)5/h7-10,17H,6,11-15H2,1-5H3 |
| InChIKey | NEDHMZFZWJFZCX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|