C24H24N2O4S — CID 55394850
N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 55394850) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55394850 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NCC3COc4ccccc4C3)c2)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-17-9-11-21(12-10-17)26-31(28,29)22-7-4-6-20(14-22)24(27)25-15-18-13-19-5-2-3-8-23(19)30-16-18/h2-12,14,18,26H,13,15-16H2,1H3,(H,25,27) |
| InChIKey | QWLCKFBCDHWLLD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |