C24H26N2O3 — CID 55394955
N-(3,4-dihydro-2H-chromen-3-ylmethyl)-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55394955) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-3-ylmethyl)-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55394955 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-1-(4-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)NCC3COc4ccccc4C3)c2C)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-16-12-22(17(2)26(16)20-8-10-21(28-3)11-9-20)24(27)25-14-18-13-19-6-4-5-7-23(19)29-15-18/h4-12,18H,13-15H2,1-3H3,(H,25,27) |
| InChIKey | KDFWZZXIFIUFCX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|