C25H33N3O4 — CID 55396567
4-butoxy-N-[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl]benzamide (PubChem CID 55396567) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-butoxy-N-[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55396567 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 4-butoxy-N-[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NCc2ccccc2CN2CCOCC2)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-2-3-14-32-23-10-8-20(9-11-23)25(30)27-18-24(29)26-17-21-6-4-5-7-22(21)19-28-12-15-31-16-13-28/h4-11H,2-3,12-19H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | KRMDMNHGLSXWQM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|