C23H29N3O4 — CID 9481299
4-ethoxy-N-[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl]benzamide (PubChem CID 9481299) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9481299 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-ethoxy-N-[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)NCc2ccccc2CN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-2-30-21-9-7-18(8-10-21)23(28)25-16-22(27)24-15-19-5-3-4-6-20(19)17-26-11-13-29-14-12-26/h3-10H,2,11-17H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | PCIHWDVHYSXRKV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |