C28H32N4O4 — CID 47064288
N-(4-ethoxyphenyl)-4-[[2-[2-(morpholin-4-ylmethyl)anilino]acetyl]amino]benzamide (PubChem CID 47064288) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[[2-[2-(morpholin-4-ylmethyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[[2-[2-(morpholin-4-ylmethyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 47064288 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[[2-[2-(morpholin-4-ylmethyl)anilino]acetyl]amino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)CNc3ccccc3CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O4/c1-2-36-25-13-11-24(12-14-25)31-28(34)21-7-9-23(10-8-21)30-27(33)19-29-26-6-4-3-5-22(26)20-32-15-17-35-18-16-32/h3-14,29H,2,15-20H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | ADCHDMYNUMKZPK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |