C20H17F4NO3 — CID 55397065
[2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 55397065) has the molecular formula C20H17F4NO3 and a molecular weight of 395.35 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55397065 |
| Molecular Formula | C20H17F4NO3 |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl-methylamino]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CN(Cc1ccccc1F)C(=O)COC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F4NO3/c1-25(12-15-6-2-3-8-17(15)21)18(26)13-28-19(27)10-9-14-5-4-7-16(11-14)20(22,23)24/h2-11H,12-13H2,1H3/b10-9+ |
| InChIKey | CSYCFPJFMVZESX-MDZDMXLPSA-N |
| XLogP | 4.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|