C20H22N6O2 — CID 55400343
N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide (PubChem CID 55400343) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide.
| Compound Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 55400343 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)COc1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C20H22N6O2/c1-15-11-16(25-9-2-3-10-25)7-8-19(15)22-20(27)13-28-18-6-4-5-17(12-18)26-14-21-23-24-26/h4-8,11-12,14H,2-3,9-10,13H2,1H3,(H,22,27) |
| InChIKey | SVTRRHRSLGTAEC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|