C14H11ClN6O2 — CID 7768398
N-(2-chloro-3-pyridinyl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide (PubChem CID 7768398) has the molecular formula C14H11ClN6O2 and a molecular weight of 330.74 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 7768398 |
| Molecular Formula | C14H11ClN6O2 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide |
| SMILES | O=C(COc1cccc(-n2cnnn2)c1)Nc1cccnc1Cl |
| InChI | InChI=1S/C14H11ClN6O2/c15-14-12(5-2-6-16-14)18-13(22)8-23-11-4-1-3-10(7-11)21-9-17-19-20-21/h1-7,9H,8H2,(H,18,22) |
| InChIKey | IYGKTZVDCWZURJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|