C19H27FN2O5S — CID 55406804
methyl 2-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]-4-methylpentanoate (PubChem CID 55406804) has the molecular formula C19H27FN2O5S and a molecular weight of 414.50 g/mol. Its IUPAC name is methyl 2-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 55406804 |
| Molecular Formula | C19H27FN2O5S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | methyl 2-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H27FN2O5S/c1-13(2)11-17(19(24)27-3)21-18(23)14-5-4-10-22(12-14)28(25,26)16-8-6-15(20)7-9-16/h6-9,13-14,17H,4-5,10-12H2,1-3H3,(H,21,23) |
| InChIKey | JPBPTEISSARSKU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |