C22H26ClN5O4 — CID 55411376
2-[[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55411376) has the molecular formula C22H26ClN5O4 and a molecular weight of 459.93 g/mol. Its IUPAC name is 2-[[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55411376 |
| Molecular Formula | C22H26ClN5O4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-[[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-methylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN(CC(=O)NNC(=O)c1ccccc1Cl)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H26ClN5O4/c1-27(15-21(30)25-26-22(31)18-4-2-3-5-19(18)23)14-20(29)24-16-6-8-17(9-7-16)28-10-12-32-13-11-28/h2-9H,10-15H2,1H3,(H,24,29)(H,25,30)(H,26,31) |
| InChIKey | PJUFDFAJGLZYOU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|