C15H18N4O4S2 — CID 55411737
2-[(E)-[amino(thiophen-3-yl)methylidene]amino]oxy-N-[3-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 55411737) has the molecular formula C15H18N4O4S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[(E)-[amino(thiophen-3-yl)methylidene]amino]oxy-N-[3-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(E)-[amino(thiophen-3-yl)methylidene]amino]oxy-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55411737 |
| Molecular Formula | C15H18N4O4S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[(E)-[amino(thiophen-3-yl)methylidene]amino]oxy-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CO/N=C(/N)c2ccsc2)c1 |
| InChI | InChI=1S/C15H18N4O4S2/c1-19(2)25(21,22)13-5-3-4-12(8-13)17-14(20)9-23-18-15(16)11-6-7-24-10-11/h3-8,10H,9H2,1-2H3,(H2,16,18)(H,17,20) |
| InChIKey | NSBGAAPCFNPKGX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|