C20H23FN2O5S2 — CID 55420201
[1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(benzenesulfonamido)-4-methylsulfanylbutanoate (PubChem CID 55420201) has the molecular formula C20H23FN2O5S2 and a molecular weight of 454.55 g/mol. Its IUPAC name is [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(benzenesulfonamido)-4-methylsulfanylbutanoate.
| Compound Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 55420201 |
| Molecular Formula | C20H23FN2O5S2 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1)C(=O)OC(C)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H23FN2O5S2/c1-14(19(24)22-16-8-6-7-15(21)13-16)28-20(25)18(11-12-29-2)23-30(26,27)17-9-4-3-5-10-17/h3-10,13-14,18,23H,11-12H2,1-2H3,(H,22,24) |
| InChIKey | POAJZKYAENKWIM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |