C17H17ClN6OS — CID 55420581
N-(2-chloro-3-pyridinyl)-2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 55420581) has the molecular formula C17H17ClN6OS and a molecular weight of 388.88 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 55420581 |
| Molecular Formula | C17H17ClN6OS |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CCn1c(SC(C)C(=O)Nc2cccnc2Cl)nnc1-c1ccncc1 |
| InChI | InChI=1S/C17H17ClN6OS/c1-3-24-15(12-6-9-19-10-7-12)22-23-17(24)26-11(2)16(25)21-13-5-4-8-20-14(13)18/h4-11H,3H2,1-2H3,(H,21,25) |
| InChIKey | MKDPPNCWMIZUJB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|