C17H17ClN6O2S2 — CID 55540742
2-[[4-(3-amino-3-oxopropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)propanamide (PubChem CID 55540742) has the molecular formula C17H17ClN6O2S2 and a molecular weight of 436.95 g/mol. Its IUPAC name is 2-[[4-(3-amino-3-oxopropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)propanamide.
| Compound Name | 2-[[4-(3-amino-3-oxopropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 55540742 |
| Molecular Formula | C17H17ClN6O2S2 |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-[[4-(3-amino-3-oxopropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)propanamide |
| SMILES | CC(Sc1nnc(-c2cccs2)n1CCC(N)=O)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H17ClN6O2S2/c1-10(16(26)21-11-4-2-7-20-14(11)18)28-17-23-22-15(12-5-3-9-27-12)24(17)8-6-13(19)25/h2-5,7,9-10H,6,8H2,1H3,(H2,19,25)(H,21,26) |
| InChIKey | DZCSDMAMXVYELO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|