C17H16ClN5OS2 — CID 9383117
(2R)-N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 9383117) has the molecular formula C17H16ClN5OS2 and a molecular weight of 405.94 g/mol. Its IUPAC name is (2R)-N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 9383117 |
| Molecular Formula | C17H16ClN5OS2 |
| Molecular Weight | 405.94 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (2R)-N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1nnc(-c2cccs2)n1C1CC1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H16ClN5OS2/c1-10(16(24)20-12-4-2-8-19-14(12)18)26-17-22-21-15(13-5-3-9-25-13)23(17)11-6-7-11/h2-5,8-11H,6-7H2,1H3,(H,20,24)/t10-/m1/s1 |
| InChIKey | CUTLPFZZJNWDFO-SNVBAGLBSA-N |
| XLogP | 4.51 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.94 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|