C25H25N5OS — CID 55421996
2-[[4-ethyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 55421996) has the molecular formula C25H25N5OS and a molecular weight of 443.58 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | 2-[[4-ethyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 55421996 |
| Molecular Formula | C25H25N5OS |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[[4-ethyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Sc1nnc(-c2cc(-c3ccccc3)nc3ccccc23)n1CC |
| InChI | InChI=1S/C25H25N5OS/c1-4-15-26-24(31)17(3)32-25-29-28-23(30(25)5-2)20-16-22(18-11-7-6-8-12-18)27-21-14-10-9-13-19(20)21/h4,6-14,16-17H,1,5,15H2,2-3H3,(H,26,31) |
| InChIKey | XVCAEDHQCVZJCW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|