C27H27N5OS — CID 42977974
N-cyclopropyl-2-[[5-[2-(4-methylphenyl)quinolin-4-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 42977974) has the molecular formula C27H27N5OS and a molecular weight of 469.61 g/mol. Its IUPAC name is N-cyclopropyl-2-[[5-[2-(4-methylphenyl)quinolin-4-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-cyclopropyl-2-[[5-[2-(4-methylphenyl)quinolin-4-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 42977974 |
| Molecular Formula | C27H27N5OS |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-cyclopropyl-2-[[5-[2-(4-methylphenyl)quinolin-4-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)NC2CC2)nnc1-c1cc(-c2ccc(C)cc2)nc2ccccc12 |
| InChI | InChI=1S/C27H27N5OS/c1-4-15-32-25(30-31-27(32)34-18(3)26(33)28-20-13-14-20)22-16-24(19-11-9-17(2)10-12-19)29-23-8-6-5-7-21(22)23/h4-12,16,18,20H,1,13-15H2,2-3H3,(H,28,33) |
| InChIKey | DHLYHUBKSDEFOS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|