C16H13ClFN5OS — CID 55422491
N-(2-chloro-3-pyridinyl)-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 55422491) has the molecular formula C16H13ClFN5OS and a molecular weight of 377.83 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 55422491 |
| Molecular Formula | C16H13ClFN5OS |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CC(Sc1n[nH]c(-c2ccccc2F)n1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H13ClFN5OS/c1-9(15(24)20-12-7-4-8-19-13(12)17)25-16-21-14(22-23-16)10-5-2-3-6-11(10)18/h2-9H,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | FTHVSUZAWCLOMV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|