C15H17ClN4OS — CID 8735108
(2S)-N-(2-chloro-3-pyridinyl)-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanamide (PubChem CID 8735108) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is (2S)-N-(2-chloro-3-pyridinyl)-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(2-chloro-3-pyridinyl)-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8735108 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (2S)-N-(2-chloro-3-pyridinyl)-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanamide |
| SMILES | Cc1nc(S[C@@H](C)C(=O)Nc2cccnc2Cl)nc(C)c1C |
| InChI | InChI=1S/C15H17ClN4OS/c1-8-9(2)18-15(19-10(8)3)22-11(4)14(21)20-12-6-5-7-17-13(12)16/h5-7,11H,1-4H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | HZPHDKUGTSKZDB-NSHDSACASA-N |
| XLogP | 3.57 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|