C22H23FN4O4 — CID 55427532
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 55427532) has the molecular formula C22H23FN4O4 and a molecular weight of 426.45 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 55427532 |
| Molecular Formula | C22H23FN4O4 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | CC(OC(=O)CCc1nc(-c2ccc(F)cc2)no1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H23FN4O4/c1-14(22(29)24-17-8-10-18(11-9-17)27(2)3)30-20(28)13-12-19-25-21(26-31-19)15-4-6-16(23)7-5-15/h4-11,14H,12-13H2,1-3H3,(H,24,29) |
| InChIKey | VBURYVDTUNSLCY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|