C17H16ClF3N2O5 — CID 55427601
[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-(2,5-dioxopyrrolidin-1-yl)propanoate (PubChem CID 55427601) has the molecular formula C17H16ClF3N2O5 and a molecular weight of 420.77 g/mol. Its IUPAC name is [1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-(2,5-dioxopyrrolidin-1-yl)propanoate.
| Compound Name | [1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-(2,5-dioxopyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 55427601 |
| Molecular Formula | C17H16ClF3N2O5 |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | [1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] 3-(2,5-dioxopyrrolidin-1-yl)propanoate |
| SMILES | CC(OC(=O)CCN1C(=O)CCC1=O)C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C17H16ClF3N2O5/c1-9(28-15(26)6-7-23-13(24)4-5-14(23)25)16(27)22-12-3-2-10(18)8-11(12)17(19,20)21/h2-3,8-9H,4-7H2,1H3,(H,22,27) |
| InChIKey | LQWPCCGIWAVEKB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|