C23H27ClN4O — CID 55428267
N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-(2-ethylbenzimidazol-1-yl)acetamide (PubChem CID 55428267) has the molecular formula C23H27ClN4O and a molecular weight of 410.95 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-(2-ethylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-(2-ethylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 55428267 |
| Molecular Formula | C23H27ClN4O |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-(2-ethylbenzimidazol-1-yl)acetamide |
| SMILES | CCc1nc2ccccc2n1CC(=O)NC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H27ClN4O/c1-2-22-26-20-5-3-4-6-21(20)28(22)16-23(29)25-19-11-13-27(14-12-19)15-17-7-9-18(24)10-8-17/h3-10,19H,2,11-16H2,1H3,(H,25,29) |
| InChIKey | ZTUTZBTVACLAFA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |