C18H19N5O3S — CID 55428757
3,5-dimethyl-N'-[2-(4-methylanilino)acetyl]-4-oxothieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 55428757) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 3,5-dimethyl-N'-[2-(4-methylanilino)acetyl]-4-oxothieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | 3,5-dimethyl-N'-[2-(4-methylanilino)acetyl]-4-oxothieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 55428757 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3,5-dimethyl-N'-[2-(4-methylanilino)acetyl]-4-oxothieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2sc3ncn(C)c(=O)c3c2C)cc1 |
| InChI | InChI=1S/C18H19N5O3S/c1-10-4-6-12(7-5-10)19-8-13(24)21-22-16(25)15-11(2)14-17(27-15)20-9-23(3)18(14)26/h4-7,9,19H,8H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | LYUDXAOIJQUHDZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|