C20H21N3O3S2 — CID 55430327
(2-anilino-2-oxoethyl) 4-[[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]amino]butanoate (PubChem CID 55430327) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 4-[[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]amino]butanoate.
| Compound Name | (2-anilino-2-oxoethyl) 4-[[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 55430327 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (2-anilino-2-oxoethyl) 4-[[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]amino]butanoate |
| SMILES | Cc1ccc(-c2csc(NCCCC(=O)OCC(=O)Nc3ccccc3)n2)s1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-14-9-10-17(28-14)16-13-27-20(23-16)21-11-5-8-19(25)26-12-18(24)22-15-6-3-2-4-7-15/h2-4,6-7,9-10,13H,5,8,11-12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | HRVKVKFDNNFXKK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|