C25H25FN2O3 — CID 55431310
N-[1-[2-(2-fluorophenoxy)ethyl-methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 55431310) has the molecular formula C25H25FN2O3 and a molecular weight of 420.48 g/mol. Its IUPAC name is N-[1-[2-(2-fluorophenoxy)ethyl-methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | N-[1-[2-(2-fluorophenoxy)ethyl-methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 55431310 |
| Molecular Formula | C25H25FN2O3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[1-[2-(2-fluorophenoxy)ethyl-methylamino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | CN(CCOc1ccccc1F)C(=O)C(Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25FN2O3/c1-28(16-17-31-23-15-9-8-14-21(23)26)25(30)22(18-19-10-4-2-5-11-19)27-24(29)20-12-6-3-7-13-20/h2-15,22H,16-18H2,1H3,(H,27,29) |
| InChIKey | KCOQRURVGYNEAS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |