C22H27FN2O4 — CID 55897590
4-fluoro-N-[1-[2-(2-methoxyphenoxy)ethyl-methylamino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 55897590) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is 4-fluoro-N-[1-[2-(2-methoxyphenoxy)ethyl-methylamino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[1-[2-(2-methoxyphenoxy)ethyl-methylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55897590 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 4-fluoro-N-[1-[2-(2-methoxyphenoxy)ethyl-methylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccccc1OCCN(C)C(=O)C(NC(=O)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C22H27FN2O4/c1-15(2)20(24-21(26)16-9-11-17(23)12-10-16)22(27)25(3)13-14-29-19-8-6-5-7-18(19)28-4/h5-12,15,20H,13-14H2,1-4H3,(H,24,26) |
| InChIKey | YWPDZGRQJCLYLV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |