C20H23N3O6S — CID 55433514
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]benzohydrazide (PubChem CID 55433514) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]benzohydrazide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55433514 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N'-[2-(2-ethoxyphenoxy)acetyl]benzohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C20H23N3O6S/c1-2-28-17-6-3-4-7-18(17)29-14-19(24)21-22-20(25)15-8-10-16(11-9-15)23-12-5-13-30(23,26)27/h3-4,6-11H,2,5,12-14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | WBOJFPCHCCAREF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|