C16H22N2O6S — CID 55435641
2-[(E)-(2,3-dimethoxyphenyl)methylideneamino]oxy-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 55435641) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[(E)-(2,3-dimethoxyphenyl)methylideneamino]oxy-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 2-[(E)-(2,3-dimethoxyphenyl)methylideneamino]oxy-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 55435641 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[(E)-(2,3-dimethoxyphenyl)methylideneamino]oxy-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | COc1cccc(/C=N/OC(C)C(=O)NC2CCS(=O)(=O)C2)c1OC |
| InChI | InChI=1S/C16H22N2O6S/c1-11(16(19)18-13-7-8-25(20,21)10-13)24-17-9-12-5-4-6-14(22-2)15(12)23-3/h4-6,9,11,13H,7-8,10H2,1-3H3,(H,18,19)/b17-9+ |
| InChIKey | GCOMEJQFGKMDDO-RQZCQDPDSA-N |
| XLogP | 0.75 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|