C15H30N2O — CID 55437784
N-(cyclohexylmethyl)-2-(dipropylamino)acetamide (PubChem CID 55437784) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-(dipropylamino)acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-(dipropylamino)acetamide |
|---|---|
| PubChem CID | 55437784 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N-(cyclohexylmethyl)-2-(dipropylamino)acetamide |
| SMILES | CCCN(CCC)CC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C15H30N2O/c1-3-10-17(11-4-2)13-15(18)16-12-14-8-6-5-7-9-14/h14H,3-13H2,1-2H3,(H,16,18) |
| InChIKey | ASNCPQGOLZPOQG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |