C18H32N4O2 — CID 78821439
2-[2-cyanoethyl(2-morpholin-4-ylethyl)amino]-N-(cyclohexylmethyl)acetamide (PubChem CID 78821439) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-[2-cyanoethyl(2-morpholin-4-ylethyl)amino]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[2-cyanoethyl(2-morpholin-4-ylethyl)amino]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 78821439 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 2-[2-cyanoethyl(2-morpholin-4-ylethyl)amino]-N-(cyclohexylmethyl)acetamide |
| SMILES | N#CCCN(CCN1CCOCC1)CC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C18H32N4O2/c19-7-4-8-22(10-9-21-11-13-24-14-12-21)16-18(23)20-15-17-5-2-1-3-6-17/h17H,1-6,8-16H2,(H,20,23) |
| InChIKey | HLMMXLSFCPYQGY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |