C14H16BrNO4S — CID 55442847
2-(3-bromophenoxy)ethyl 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 55442847) has the molecular formula C14H16BrNO4S and a molecular weight of 374.26 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | 2-(3-bromophenoxy)ethyl 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 55442847 |
| Molecular Formula | C14H16BrNO4S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | O=C(CCN1CCSC1=O)OCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C14H16BrNO4S/c15-11-2-1-3-12(10-11)19-7-8-20-13(17)4-5-16-6-9-21-14(16)18/h1-3,10H,4-9H2 |
| InChIKey | AGYMJEUFPGUGRP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|