C12H15N3O3S — CID 63579041
3-[2-(2-oxo-1,3-thiazolidin-3-yl)ethoxy]benzohydrazide (PubChem CID 63579041) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-[2-(2-oxo-1,3-thiazolidin-3-yl)ethoxy]benzohydrazide.
| Compound Name | 3-[2-(2-oxo-1,3-thiazolidin-3-yl)ethoxy]benzohydrazide |
|---|---|
| PubChem CID | 63579041 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-[2-(2-oxo-1,3-thiazolidin-3-yl)ethoxy]benzohydrazide |
| SMILES | NNC(=O)c1cccc(OCCN2CCSC2=O)c1 |
| InChI | InChI=1S/C12H15N3O3S/c13-14-11(16)9-2-1-3-10(8-9)18-6-4-15-5-7-19-12(15)17/h1-3,8H,4-7,13H2,(H,14,16) |
| InChIKey | ULJHQGBHLHADJF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|