C21H22FN9OS — CID 55442994
6-[[4-amino-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 55442994) has the molecular formula C21H22FN9OS and a molecular weight of 467.53 g/mol. Its IUPAC name is 6-[[4-amino-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[4-amino-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 55442994 |
| Molecular Formula | C21H22FN9OS |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 6-[[4-amino-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(2-ethylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1ccccc1Nc1nc(N)nc(CSc2nnc(COc3ccc(F)cc3)n2N)n1 |
| InChI | InChI=1S/C21H22FN9OS/c1-2-13-5-3-4-6-16(13)25-20-27-17(26-19(23)28-20)12-33-21-30-29-18(31(21)24)11-32-15-9-7-14(22)8-10-15/h3-10H,2,11-12,24H2,1H3,(H3,23,25,26,27,28) |
| InChIKey | NJUJBIKLJRKRTG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |