C23H19NO6S — CID 55444341
(7-methoxy-2-oxochromen-4-yl)methyl 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzoate (PubChem CID 55444341) has the molecular formula C23H19NO6S and a molecular weight of 437.47 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 55444341 |
| Molecular Formula | C23H19NO6S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]benzoate |
| SMILES | COc1ccc2c(COC(=O)c3ccccc3SCc3cc(C)no3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H19NO6S/c1-14-9-17(30-24-14)13-31-21-6-4-3-5-19(21)23(26)28-12-15-10-22(25)29-20-11-16(27-2)7-8-18(15)20/h3-11H,12-13H2,1-2H3 |
| InChIKey | MANCEOPMBJNCDX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 91.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|