C17H24ClN3O3 — CID 55447068
2-[4-(5-chloro-2-hydroxybenzoyl)piperazin-1-yl]-N,N-diethylacetamide (PubChem CID 55447068) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-[4-(5-chloro-2-hydroxybenzoyl)piperazin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-(5-chloro-2-hydroxybenzoyl)piperazin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 55447068 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-[4-(5-chloro-2-hydroxybenzoyl)piperazin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)c2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-3-20(4-2)16(23)12-19-7-9-21(10-8-19)17(24)14-11-13(18)5-6-15(14)22/h5-6,11,22H,3-4,7-10,12H2,1-2H3 |
| InChIKey | WACLEZKMNFPGJQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |