C20H25ClN4O2 — CID 55871061
2-[4-(6-chloroquinoline-8-carbonyl)piperazin-1-yl]-N,N-diethylacetamide (PubChem CID 55871061) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-[4-(6-chloroquinoline-8-carbonyl)piperazin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-(6-chloroquinoline-8-carbonyl)piperazin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 55871061 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[4-(6-chloroquinoline-8-carbonyl)piperazin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)c2cc(Cl)cc3cccnc23)CC1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-3-24(4-2)18(26)14-23-8-10-25(11-9-23)20(27)17-13-16(21)12-15-6-5-7-22-19(15)17/h5-7,12-13H,3-4,8-11,14H2,1-2H3 |
| InChIKey | HOTONFHBFDYMHJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |