C22H25NO7S — CID 55448619
[1-[5-(acetamidomethyl)thiophen-2-yl]-1-oxopropan-2-yl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 55448619) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is [1-[5-(acetamidomethyl)thiophen-2-yl]-1-oxopropan-2-yl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [1-[5-(acetamidomethyl)thiophen-2-yl]-1-oxopropan-2-yl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55448619 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [1-[5-(acetamidomethyl)thiophen-2-yl]-1-oxopropan-2-yl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)OC(C)C(=O)c1ccc(CNC(C)=O)s1 |
| InChI | InChI=1S/C22H25NO7S/c1-13(22(26)20-8-7-16(31-20)12-23-14(2)24)30-21(25)9-6-15-10-18(28-4)19(29-5)11-17(15)27-3/h6-11,13H,12H2,1-5H3,(H,23,24)/b9-6+ |
| InChIKey | XSPWVJCFRHFKFG-RMKNXTFCSA-N |
| XLogP | 3.24 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|