C19H18F3N3O3 — CID 55450565
3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N'-[2-(trifluoromethyl)phenyl]propanehydrazide (PubChem CID 55450565) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N'-[2-(trifluoromethyl)phenyl]propanehydrazide.
| Compound Name | 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N'-[2-(trifluoromethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 55450565 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N'-[2-(trifluoromethyl)phenyl]propanehydrazide |
| SMILES | CC1Oc2ccccc2N(CCC(=O)NNc2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C19H18F3N3O3/c1-12-18(27)25(15-8-4-5-9-16(15)28-12)11-10-17(26)24-23-14-7-3-2-6-13(14)19(20,21)22/h2-9,12,23H,10-11H2,1H3,(H,24,26) |
| InChIKey | AHNBAHFGOOQNRT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|