C18H16F3N3O3 — CID 55386609
3-(3-oxo-1,4-benzoxazin-4-yl)-N'-[2-(trifluoromethyl)phenyl]propanehydrazide (PubChem CID 55386609) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is 3-(3-oxo-1,4-benzoxazin-4-yl)-N'-[2-(trifluoromethyl)phenyl]propanehydrazide.
| Compound Name | 3-(3-oxo-1,4-benzoxazin-4-yl)-N'-[2-(trifluoromethyl)phenyl]propanehydrazide |
|---|---|
| PubChem CID | 55386609 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-(3-oxo-1,4-benzoxazin-4-yl)-N'-[2-(trifluoromethyl)phenyl]propanehydrazide |
| SMILES | O=C(CCN1C(=O)COc2ccccc21)NNc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O3/c19-18(20,21)12-5-1-2-6-13(12)22-23-16(25)9-10-24-14-7-3-4-8-15(14)27-11-17(24)26/h1-8,22H,9-11H2,(H,23,25) |
| InChIKey | XLQLEWHTTWLGIP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|