C21H18N4O4 — CID 35069219
N'-[3-(3-oxo-1,4-benzoxazin-4-yl)propanoyl]quinoline-2-carbohydrazide (PubChem CID 35069219) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is N'-[3-(3-oxo-1,4-benzoxazin-4-yl)propanoyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[3-(3-oxo-1,4-benzoxazin-4-yl)propanoyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 35069219 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N'-[3-(3-oxo-1,4-benzoxazin-4-yl)propanoyl]quinoline-2-carbohydrazide |
| SMILES | O=C(CCN1C(=O)COc2ccccc21)NNC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H18N4O4/c26-19(11-12-25-17-7-3-4-8-18(17)29-13-20(25)27)23-24-21(28)16-10-9-14-5-1-2-6-15(14)22-16/h1-10H,11-13H2,(H,23,26)(H,24,28) |
| InChIKey | RRSRKHJRHMIUAY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|