C19H32N4O6S — CID 55451925
tert-butyl N-[4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]-4-oxobutyl]carbamate (PubChem CID 55451925) has the molecular formula C19H32N4O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55451925 |
| Molecular Formula | C19H32N4O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl N-[4-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]-4-oxobutyl]carbamate |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCN(C(=O)CCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H32N4O6S/c1-14-17(15(2)29-21-14)30(26,27)23-11-7-10-22(12-13-23)16(24)8-6-9-20-18(25)28-19(3,4)5/h6-13H2,1-5H3,(H,20,25) |
| InChIKey | IPQFYBQUSCUJQX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|