C28H24N6O3 — CID 55453582
1-[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]ethanone (PubChem CID 55453582) has the molecular formula C28H24N6O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]ethanone.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 55453582 |
| Molecular Formula | C28H24N6O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-2-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]ethanone |
| SMILES | O=C(Cc1cn(-c2ccccc2)nc1-c1ccc([N+](=O)[O-])cc1)N1CCCC1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H24N6O3/c35-26(32-16-6-11-25(32)28-29-23-9-4-5-10-24(23)30-28)17-20-18-33(21-7-2-1-3-8-21)31-27(20)19-12-14-22(15-13-19)34(36)37/h1-5,7-10,12-15,18,25H,6,11,16-17H2,(H,29,30) |
| InChIKey | XRRYDCJFKPDARM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|