C20H23N5O3S2 — CID 55454690
N-methyl-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 55454690) has the molecular formula C20H23N5O3S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-methyl-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | N-methyl-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55454690 |
| Molecular Formula | C20H23N5O3S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-methyl-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)N(C)C(C)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H23N5O3S2/c1-13-4-6-16(7-5-13)19-22-23-20(29)25(19)12-18(26)24(3)14(2)15-8-10-17(11-9-15)30(21,27)28/h4-11,14H,12H2,1-3H3,(H,23,29)(H2,21,27,28) |
| InChIKey | ILBNVRHNVZZMTK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|