C29H34N4O2 — CID 55456894
N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide (PubChem CID 55456894) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55456894 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCN(C(=O)c3cccc4ccccc34)CC2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C29H34N4O2/c1-21-20-24(10-11-27(21)32-18-16-31(2)17-19-32)30-28(34)23-12-14-33(15-13-23)29(35)26-9-5-7-22-6-3-4-8-25(22)26/h3-11,20,23H,12-19H2,1-2H3,(H,30,34) |
| InChIKey | FLVSUDZUSLEWQH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|