C18H17N5OS3 — CID 55458902
7-methyl-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 55458902) has the molecular formula C18H17N5OS3 and a molecular weight of 415.57 g/mol. Its IUPAC name is 7-methyl-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-methyl-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 55458902 |
| Molecular Formula | C18H17N5OS3 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 7-methyl-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1CCc2c(sc3nc(CSc4nnc(-c5cccs5)o4)nc(N)c23)C1 |
| InChI | InChI=1S/C18H17N5OS3/c1-9-4-5-10-12(7-9)27-17-14(10)15(19)20-13(21-17)8-26-18-23-22-16(24-18)11-3-2-6-25-11/h2-3,6,9H,4-5,7-8H2,1H3,(H2,19,20,21) |
| InChIKey | SEOIWRFGSUCAQW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |