C23H24N6S2 — CID 55458900
2-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 55458900) has the molecular formula C23H24N6S2 and a molecular weight of 448.62 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 55458900 |
| Molecular Formula | C23H24N6S2 |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1CCc2c(sc3nc(CSc4nnc(C5CC5)n4-c4ccccc4)nc(N)c23)C1 |
| InChI | InChI=1S/C23H24N6S2/c1-13-7-10-16-17(11-13)31-22-19(16)20(24)25-18(26-22)12-30-23-28-27-21(14-8-9-14)29(23)15-5-3-2-4-6-15/h2-6,13-14H,7-12H2,1H3,(H2,24,25,26) |
| InChIKey | RVEKMMVDQNQOBU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |