C32H28ClN7O2S3 — CID 167959725
3-[5-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-N-(2-chlorophenyl)benzenesulfonamide (PubChem CID 167959725) has the molecular formula C32H28ClN7O2S3 and a molecular weight of 674.28 g/mol. Its IUPAC name is 3-[5-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-N-(2-chlorophenyl)benzenesulfonamide.
| Compound Name | 3-[5-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-N-(2-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167959725 |
| Molecular Formula | C32H28ClN7O2S3 |
| Molecular Weight | 674.28 g/mol |
| Exact Mass | 673.12 |
| IUPAC Name | 3-[5-[(4-amino-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-N-(2-chlorophenyl)benzenesulfonamide |
| SMILES | CC1CCc2c(sc3nc(CSc4nnc(-c5cccc(S(=O)(=O)Nc6ccccc6Cl)c5)n4-c4ccccc4)nc(N)c23)C1 |
| InChI | InChI=1S/C32H28ClN7O2S3/c1-19-14-15-23-26(16-19)44-31-28(23)29(34)35-27(36-31)18-43-32-38-37-30(40(32)21-9-3-2-4-10-21)20-8-7-11-22(17-20)45(41,42)39-25-13-6-5-12-24(25)33/h2-13,17,19,39H,14-16,18H2,1H3,(H2,34,35,36) |
| InChIKey | IPOZPMNIARORGQ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.28 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |