C17H22N4O7 — CID 55459486
[1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 4-(2-methoxyethylamino)-3-nitrobenzoate (PubChem CID 55459486) has the molecular formula C17H22N4O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 4-(2-methoxyethylamino)-3-nitrobenzoate.
| Compound Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 4-(2-methoxyethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 55459486 |
| Molecular Formula | C17H22N4O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 4-(2-methoxyethylamino)-3-nitrobenzoate |
| SMILES | COCCNc1ccc(C(=O)OC(C)C(=O)NC(=O)NC2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N4O7/c1-10(15(22)20-17(24)19-12-4-5-12)28-16(23)11-3-6-13(18-7-8-27-2)14(9-11)21(25)26/h3,6,9-10,12,18H,4-5,7-8H2,1-2H3,(H2,19,20,22,24) |
| InChIKey | MJWXWNKUDZNHHY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|